C12H11FN2O3 — CID 138460839
N-(2-fluorophenyl)-2,6-dioxopiperidine-3-carboxamide (PubChem CID 138460839) has the molecular formula C12H11FN2O3 and a molecular weight of 250.23 g/mol. Its IUPAC name is N-(2-fluorophenyl)-2,6-dioxopiperidine-3-carboxamide.
| Compound Name | N-(2-fluorophenyl)-2,6-dioxopiperidine-3-carboxamide |
|---|---|
| PubChem CID | 138460839 |
| Molecular Formula | C12H11FN2O3 |
| Molecular Weight | 250.23 g/mol |
| Exact Mass | 250.08 |
| IUPAC Name | N-(2-fluorophenyl)-2,6-dioxopiperidine-3-carboxamide |
| SMILES | O=C1CCC(C(=O)Nc2ccccc2F)C(=O)N1 |
| InChI | InChI=1S/C12H11FN2O3/c13-8-3-1-2-4-9(8)14-11(17)7-5-6-10(16)15-12(7)18/h1-4,7H,5-6H2,(H,14,17)(H,15,16,18) |
| InChIKey | MMIZGZRRTKIUSB-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.23 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|