C15H13FN4O3S — CID 136884865
(5S)-N-(2-fluorophenyl)-2-methylsulfanyl-4,7-dioxo-3,5,6,8-tetrahydropyrido[2,3-d]pyrimidine-5-carboxamide (PubChem CID 136884865) has the molecular formula C15H13FN4O3S and a molecular weight of 348.36 g/mol. Its IUPAC name is (5S)-N-(2-fluorophenyl)-2-methylsulfanyl-4,7-dioxo-3,5,6,8-tetrahydropyrido[2,3-d]pyrimidine-5-carboxamide.
| Compound Name | (5S)-N-(2-fluorophenyl)-2-methylsulfanyl-4,7-dioxo-3,5,6,8-tetrahydropyrido[2,3-d]pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 136884865 |
| Molecular Formula | C15H13FN4O3S |
| Molecular Weight | 348.36 g/mol |
| Exact Mass | 348.07 |
| IUPAC Name | (5S)-N-(2-fluorophenyl)-2-methylsulfanyl-4,7-dioxo-3,5,6,8-tetrahydropyrido[2,3-d]pyrimidine-5-carboxamide |
| SMILES | CSc1nc2c(c(=O)[nH]1)[C@@H](C(=O)Nc1ccccc1F)CC(=O)N2 |
| InChI | InChI=1S/C15H13FN4O3S/c1-24-15-19-12-11(14(23)20-15)7(6-10(21)18-12)13(22)17-9-5-3-2-4-8(9)16/h2-5,7H,6H2,1H3,(H,17,22)(H2,18,19,20,21,23)/t7-/m0/s1 |
| InChIKey | TYBPEWSTEDODQT-ZETCQYMHSA-N |
| XLogP | 1.70 |
| TPSA | 103.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.36 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |