C16H13F3N4O3S — CID 136884874
(5R)-2-methylsulfanyl-4,7-dioxo-N-[4-(trifluoromethyl)phenyl]-3,5,6,8-tetrahydropyrido[2,3-d]pyrimidine-5-carboxamide (PubChem CID 136884874) has the molecular formula C16H13F3N4O3S and a molecular weight of 398.37 g/mol. Its IUPAC name is (5R)-2-methylsulfanyl-4,7-dioxo-N-[4-(trifluoromethyl)phenyl]-3,5,6,8-tetrahydropyrido[2,3-d]pyrimidine-5-carboxamide.
| Compound Name | (5R)-2-methylsulfanyl-4,7-dioxo-N-[4-(trifluoromethyl)phenyl]-3,5,6,8-tetrahydropyrido[2,3-d]pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 136884874 |
| Molecular Formula | C16H13F3N4O3S |
| Molecular Weight | 398.37 g/mol |
| Exact Mass | 398.07 |
| IUPAC Name | (5R)-2-methylsulfanyl-4,7-dioxo-N-[4-(trifluoromethyl)phenyl]-3,5,6,8-tetrahydropyrido[2,3-d]pyrimidine-5-carboxamide |
| SMILES | CSc1nc2c(c(=O)[nH]1)[C@H](C(=O)Nc1ccc(C(F)(F)F)cc1)CC(=O)N2 |
| InChI | InChI=1S/C16H13F3N4O3S/c1-27-15-22-12-11(14(26)23-15)9(6-10(24)21-12)13(25)20-8-4-2-7(3-5-8)16(17,18)19/h2-5,9H,6H2,1H3,(H,20,25)(H2,21,22,23,24,26)/t9-/m1/s1 |
| InChIKey | IQDPQYQWDHWXDW-SECBINFHSA-N |
| XLogP | 2.58 |
| TPSA | 103.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.37 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |