C23H19F3N6O4 — CID 136876629
(5S)-N-(4-acetamidophenyl)-4,7-dioxo-2-[3-(trifluoromethyl)anilino]-3,5,6,8-tetrahydropyrido[2,3-d]pyrimidine-5-carboxamide (PubChem CID 136876629) has the molecular formula C23H19F3N6O4 and a molecular weight of 500.44 g/mol. Its IUPAC name is (5S)-N-(4-acetamidophenyl)-4,7-dioxo-2-[3-(trifluoromethyl)anilino]-3,5,6,8-tetrahydropyrido[2,3-d]pyrimidine-5-carboxamide.
| Compound Name | (5S)-N-(4-acetamidophenyl)-4,7-dioxo-2-[3-(trifluoromethyl)anilino]-3,5,6,8-tetrahydropyrido[2,3-d]pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 136876629 |
| Molecular Formula | C23H19F3N6O4 |
| Molecular Weight | 500.44 g/mol |
| Exact Mass | 500.14 |
| IUPAC Name | (5S)-N-(4-acetamidophenyl)-4,7-dioxo-2-[3-(trifluoromethyl)anilino]-3,5,6,8-tetrahydropyrido[2,3-d]pyrimidine-5-carboxamide |
| SMILES | CC(=O)Nc1ccc(NC(=O)[C@H]2CC(=O)Nc3nc(Nc4cccc(C(F)(F)F)c4)[nH]c(=O)c32)cc1 |
| InChI | InChI=1S/C23H19F3N6O4/c1-11(33)27-13-5-7-14(8-6-13)28-20(35)16-10-17(34)30-19-18(16)21(36)32-22(31-19)29-15-4-2-3-12(9-15)23(24,25)26/h2-9,16H,10H2,1H3,(H,27,33)(H,28,35)(H3,29,30,31,32,34,36)/t16-/m0/s1 |
| InChIKey | DHDDXJARXGAZBJ-INIZCTEOSA-N |
| XLogP | 3.56 |
| TPSA | 145.08 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.44 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |