C20H17N5O3 — CID 135629396
2-anilino-4,7-dioxo-N-phenyl-3,5,6,8-tetrahydropyrido[2,3-d]pyrimidine-5-carboxamide (PubChem CID 135629396) has the molecular formula C20H17N5O3 and a molecular weight of 375.39 g/mol. Its IUPAC name is 2-anilino-4,7-dioxo-N-phenyl-3,5,6,8-tetrahydropyrido[2,3-d]pyrimidine-5-carboxamide.
| Compound Name | 2-anilino-4,7-dioxo-N-phenyl-3,5,6,8-tetrahydropyrido[2,3-d]pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 135629396 |
| Molecular Formula | C20H17N5O3 |
| Molecular Weight | 375.39 g/mol |
| Exact Mass | 375.13 |
| IUPAC Name | 2-anilino-4,7-dioxo-N-phenyl-3,5,6,8-tetrahydropyrido[2,3-d]pyrimidine-5-carboxamide |
| SMILES | O=C1CC(C(=O)Nc2ccccc2)c2c(nc(Nc3ccccc3)[nH]c2=O)N1 |
| InChI | InChI=1S/C20H17N5O3/c26-15-11-14(18(27)21-12-7-3-1-4-8-12)16-17(23-15)24-20(25-19(16)28)22-13-9-5-2-6-10-13/h1-10,14H,11H2,(H,21,27)(H3,22,23,24,25,26,28) |
| InChIKey | LIHGHEMEPMIRGL-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 115.98 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.39 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |