C21H16F3N5O3 — CID 136876604
(5R)-4,7-dioxo-N-phenyl-2-[3-(trifluoromethyl)anilino]-3,5,6,8-tetrahydropyrido[2,3-d]pyrimidine-5-carboxamide (PubChem CID 136876604) has the molecular formula C21H16F3N5O3 and a molecular weight of 443.39 g/mol. Its IUPAC name is (5R)-4,7-dioxo-N-phenyl-2-[3-(trifluoromethyl)anilino]-3,5,6,8-tetrahydropyrido[2,3-d]pyrimidine-5-carboxamide.
| Compound Name | (5R)-4,7-dioxo-N-phenyl-2-[3-(trifluoromethyl)anilino]-3,5,6,8-tetrahydropyrido[2,3-d]pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 136876604 |
| Molecular Formula | C21H16F3N5O3 |
| Molecular Weight | 443.39 g/mol |
| Exact Mass | 443.12 |
| IUPAC Name | (5R)-4,7-dioxo-N-phenyl-2-[3-(trifluoromethyl)anilino]-3,5,6,8-tetrahydropyrido[2,3-d]pyrimidine-5-carboxamide |
| SMILES | O=C1C[C@@H](C(=O)Nc2ccccc2)c2c(nc(Nc3cccc(C(F)(F)F)c3)[nH]c2=O)N1 |
| InChI | InChI=1S/C21H16F3N5O3/c22-21(23,24)11-5-4-8-13(9-11)26-20-28-17-16(19(32)29-20)14(10-15(30)27-17)18(31)25-12-6-2-1-3-7-12/h1-9,14H,10H2,(H,25,31)(H3,26,27,28,29,30,32)/t14-/m1/s1 |
| InChIKey | QLOLAGCAYBXQJU-CQSZACIVSA-N |
| XLogP | 3.60 |
| TPSA | 115.98 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.39 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |