C22H17ClF3N5O3 — CID 136876671
(5S)-N-(3-chloro-2-methylphenyl)-4,7-dioxo-2-[3-(trifluoromethyl)anilino]-3,5,6,8-tetrahydropyrido[2,3-d]pyrimidine-5-carboxamide (PubChem CID 136876671) has the molecular formula C22H17ClF3N5O3 and a molecular weight of 491.86 g/mol. Its IUPAC name is (5S)-N-(3-chloro-2-methylphenyl)-4,7-dioxo-2-[3-(trifluoromethyl)anilino]-3,5,6,8-tetrahydropyrido[2,3-d]pyrimidine-5-carboxamide.
| Compound Name | (5S)-N-(3-chloro-2-methylphenyl)-4,7-dioxo-2-[3-(trifluoromethyl)anilino]-3,5,6,8-tetrahydropyrido[2,3-d]pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 136876671 |
| Molecular Formula | C22H17ClF3N5O3 |
| Molecular Weight | 491.86 g/mol |
| Exact Mass | 491.10 |
| IUPAC Name | (5S)-N-(3-chloro-2-methylphenyl)-4,7-dioxo-2-[3-(trifluoromethyl)anilino]-3,5,6,8-tetrahydropyrido[2,3-d]pyrimidine-5-carboxamide |
| SMILES | Cc1c(Cl)cccc1NC(=O)[C@H]1CC(=O)Nc2nc(Nc3cccc(C(F)(F)F)c3)[nH]c(=O)c21 |
| InChI | InChI=1S/C22H17ClF3N5O3/c1-10-14(23)6-3-7-15(10)28-19(33)13-9-16(32)29-18-17(13)20(34)31-21(30-18)27-12-5-2-4-11(8-12)22(24,25)26/h2-8,13H,9H2,1H3,(H,28,33)(H3,27,29,30,31,32,34)/t13-/m0/s1 |
| InChIKey | IHEJAQMTHAFPIM-ZDUSSCGKSA-N |
| XLogP | 4.56 |
| TPSA | 115.98 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.86 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |