C20H14Cl2FN5O3 — CID 136876359
(5S)-N-(2,3-dichlorophenyl)-2-(4-fluoroanilino)-4,7-dioxo-3,5,6,8-tetrahydropyrido[2,3-d]pyrimidine-5-carboxamide (PubChem CID 136876359) has the molecular formula C20H14Cl2FN5O3 and a molecular weight of 462.27 g/mol. Its IUPAC name is (5S)-N-(2,3-dichlorophenyl)-2-(4-fluoroanilino)-4,7-dioxo-3,5,6,8-tetrahydropyrido[2,3-d]pyrimidine-5-carboxamide.
| Compound Name | (5S)-N-(2,3-dichlorophenyl)-2-(4-fluoroanilino)-4,7-dioxo-3,5,6,8-tetrahydropyrido[2,3-d]pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 136876359 |
| Molecular Formula | C20H14Cl2FN5O3 |
| Molecular Weight | 462.27 g/mol |
| Exact Mass | 461.05 |
| IUPAC Name | (5S)-N-(2,3-dichlorophenyl)-2-(4-fluoroanilino)-4,7-dioxo-3,5,6,8-tetrahydropyrido[2,3-d]pyrimidine-5-carboxamide |
| SMILES | O=C1C[C@H](C(=O)Nc2cccc(Cl)c2Cl)c2c(nc(Nc3ccc(F)cc3)[nH]c2=O)N1 |
| InChI | InChI=1S/C20H14Cl2FN5O3/c21-12-2-1-3-13(16(12)22)25-18(30)11-8-14(29)26-17-15(11)19(31)28-20(27-17)24-10-6-4-9(23)5-7-10/h1-7,11H,8H2,(H,25,30)(H3,24,26,27,28,29,31)/t11-/m0/s1 |
| InChIKey | HVLMRWDPCPPJIL-NSHDSACASA-N |
| XLogP | 4.02 |
| TPSA | 115.98 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.27 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |