C22H20ClN5O3 — CID 136875984
(5R)-2-(4-chloroanilino)-N-(2-ethylphenyl)-4,7-dioxo-3,5,6,8-tetrahydropyrido[2,3-d]pyrimidine-5-carboxamide (PubChem CID 136875984) has the molecular formula C22H20ClN5O3 and a molecular weight of 437.89 g/mol. Its IUPAC name is (5R)-2-(4-chloroanilino)-N-(2-ethylphenyl)-4,7-dioxo-3,5,6,8-tetrahydropyrido[2,3-d]pyrimidine-5-carboxamide.
| Compound Name | (5R)-2-(4-chloroanilino)-N-(2-ethylphenyl)-4,7-dioxo-3,5,6,8-tetrahydropyrido[2,3-d]pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 136875984 |
| Molecular Formula | C22H20ClN5O3 |
| Molecular Weight | 437.89 g/mol |
| Exact Mass | 437.13 |
| IUPAC Name | (5R)-2-(4-chloroanilino)-N-(2-ethylphenyl)-4,7-dioxo-3,5,6,8-tetrahydropyrido[2,3-d]pyrimidine-5-carboxamide |
| SMILES | CCc1ccccc1NC(=O)[C@@H]1CC(=O)Nc2nc(Nc3ccc(Cl)cc3)[nH]c(=O)c21 |
| InChI | InChI=1S/C22H20ClN5O3/c1-2-12-5-3-4-6-16(12)25-20(30)15-11-17(29)26-19-18(15)21(31)28-22(27-19)24-14-9-7-13(23)8-10-14/h3-10,15H,2,11H2,1H3,(H,25,30)(H3,24,26,27,28,29,31)/t15-/m1/s1 |
| InChIKey | MHJURHMVZXVSBH-OAHLLOKOSA-N |
| XLogP | 3.79 |
| TPSA | 115.98 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.89 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |