C22H19Cl2N5O4 — CID 136876175
(5S)-2-(3,5-dichloroanilino)-N-(2-ethoxyphenyl)-4,7-dioxo-3,5,6,8-tetrahydropyrido[2,3-d]pyrimidine-5-carboxamide (PubChem CID 136876175) has the molecular formula C22H19Cl2N5O4 and a molecular weight of 488.33 g/mol. Its IUPAC name is (5S)-2-(3,5-dichloroanilino)-N-(2-ethoxyphenyl)-4,7-dioxo-3,5,6,8-tetrahydropyrido[2,3-d]pyrimidine-5-carboxamide.
| Compound Name | (5S)-2-(3,5-dichloroanilino)-N-(2-ethoxyphenyl)-4,7-dioxo-3,5,6,8-tetrahydropyrido[2,3-d]pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 136876175 |
| Molecular Formula | C22H19Cl2N5O4 |
| Molecular Weight | 488.33 g/mol |
| Exact Mass | 487.08 |
| IUPAC Name | (5S)-2-(3,5-dichloroanilino)-N-(2-ethoxyphenyl)-4,7-dioxo-3,5,6,8-tetrahydropyrido[2,3-d]pyrimidine-5-carboxamide |
| SMILES | CCOc1ccccc1NC(=O)[C@H]1CC(=O)Nc2nc(Nc3cc(Cl)cc(Cl)c3)[nH]c(=O)c21 |
| InChI | InChI=1S/C22H19Cl2N5O4/c1-2-33-16-6-4-3-5-15(16)26-20(31)14-10-17(30)27-19-18(14)21(32)29-22(28-19)25-13-8-11(23)7-12(24)9-13/h3-9,14H,2,10H2,1H3,(H,26,31)(H3,25,27,28,29,30,32)/t14-/m0/s1 |
| InChIKey | VNUQNSDUICDAAV-AWEZNQCLSA-N |
| XLogP | 4.28 |
| TPSA | 125.21 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.33 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |