C22H19Cl2N5O3 — CID 136876170
(5R)-2-(3,5-dichloroanilino)-N-(2-ethylphenyl)-4,7-dioxo-3,5,6,8-tetrahydropyrido[2,3-d]pyrimidine-5-carboxamide (PubChem CID 136876170) has the molecular formula C22H19Cl2N5O3 and a molecular weight of 472.33 g/mol. Its IUPAC name is (5R)-2-(3,5-dichloroanilino)-N-(2-ethylphenyl)-4,7-dioxo-3,5,6,8-tetrahydropyrido[2,3-d]pyrimidine-5-carboxamide.
| Compound Name | (5R)-2-(3,5-dichloroanilino)-N-(2-ethylphenyl)-4,7-dioxo-3,5,6,8-tetrahydropyrido[2,3-d]pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 136876170 |
| Molecular Formula | C22H19Cl2N5O3 |
| Molecular Weight | 472.33 g/mol |
| Exact Mass | 471.09 |
| IUPAC Name | (5R)-2-(3,5-dichloroanilino)-N-(2-ethylphenyl)-4,7-dioxo-3,5,6,8-tetrahydropyrido[2,3-d]pyrimidine-5-carboxamide |
| SMILES | CCc1ccccc1NC(=O)[C@@H]1CC(=O)Nc2nc(Nc3cc(Cl)cc(Cl)c3)[nH]c(=O)c21 |
| InChI | InChI=1S/C22H19Cl2N5O3/c1-2-11-5-3-4-6-16(11)26-20(31)15-10-17(30)27-19-18(15)21(32)29-22(28-19)25-14-8-12(23)7-13(24)9-14/h3-9,15H,2,10H2,1H3,(H,26,31)(H3,25,27,28,29,30,32)/t15-/m1/s1 |
| InChIKey | HQHWFQBLOLGHGX-OAHLLOKOSA-N |
| XLogP | 4.45 |
| TPSA | 115.98 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.33 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |