C21H18ClN5O3 — CID 136875950
(5R)-2-anilino-N-(5-chloro-2-methylphenyl)-4,7-dioxo-3,5,6,8-tetrahydropyrido[2,3-d]pyrimidine-5-carboxamide (PubChem CID 136875950) has the molecular formula C21H18ClN5O3 and a molecular weight of 423.86 g/mol. Its IUPAC name is (5R)-2-anilino-N-(5-chloro-2-methylphenyl)-4,7-dioxo-3,5,6,8-tetrahydropyrido[2,3-d]pyrimidine-5-carboxamide.
| Compound Name | (5R)-2-anilino-N-(5-chloro-2-methylphenyl)-4,7-dioxo-3,5,6,8-tetrahydropyrido[2,3-d]pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 136875950 |
| Molecular Formula | C21H18ClN5O3 |
| Molecular Weight | 423.86 g/mol |
| Exact Mass | 423.11 |
| IUPAC Name | (5R)-2-anilino-N-(5-chloro-2-methylphenyl)-4,7-dioxo-3,5,6,8-tetrahydropyrido[2,3-d]pyrimidine-5-carboxamide |
| SMILES | Cc1ccc(Cl)cc1NC(=O)[C@@H]1CC(=O)Nc2nc(Nc3ccccc3)[nH]c(=O)c21 |
| InChI | InChI=1S/C21H18ClN5O3/c1-11-7-8-12(22)9-15(11)24-19(29)14-10-16(28)25-18-17(14)20(30)27-21(26-18)23-13-5-3-2-4-6-13/h2-9,14H,10H2,1H3,(H,24,29)(H3,23,25,26,27,28,30)/t14-/m1/s1 |
| InChIKey | OKTNPRQXILSHBB-CQSZACIVSA-N |
| XLogP | 3.54 |
| TPSA | 115.98 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.86 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |