C21H18N6O5 — CID 136875936
(5R)-2-anilino-N-(2-methyl-5-nitrophenyl)-4,7-dioxo-3,5,6,8-tetrahydropyrido[2,3-d]pyrimidine-5-carboxamide (PubChem CID 136875936) has the molecular formula C21H18N6O5 and a molecular weight of 434.41 g/mol. Its IUPAC name is (5R)-2-anilino-N-(2-methyl-5-nitrophenyl)-4,7-dioxo-3,5,6,8-tetrahydropyrido[2,3-d]pyrimidine-5-carboxamide.
| Compound Name | (5R)-2-anilino-N-(2-methyl-5-nitrophenyl)-4,7-dioxo-3,5,6,8-tetrahydropyrido[2,3-d]pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 136875936 |
| Molecular Formula | C21H18N6O5 |
| Molecular Weight | 434.41 g/mol |
| Exact Mass | 434.13 |
| IUPAC Name | (5R)-2-anilino-N-(2-methyl-5-nitrophenyl)-4,7-dioxo-3,5,6,8-tetrahydropyrido[2,3-d]pyrimidine-5-carboxamide |
| SMILES | Cc1ccc([N+](=O)[O-])cc1NC(=O)[C@@H]1CC(=O)Nc2nc(Nc3ccccc3)[nH]c(=O)c21 |
| InChI | InChI=1S/C21H18N6O5/c1-11-7-8-13(27(31)32)9-15(11)23-19(29)14-10-16(28)24-18-17(14)20(30)26-21(25-18)22-12-5-3-2-4-6-12/h2-9,14H,10H2,1H3,(H,23,29)(H3,22,24,25,26,28,30)/t14-/m1/s1 |
| InChIKey | FUAQWZZJVXHZGH-CQSZACIVSA-N |
| XLogP | 2.79 |
| TPSA | 159.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.41 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|