C21H17ClN6O6 — CID 136876025
(5S)-2-(4-chloroanilino)-N-(2-methoxy-4-nitrophenyl)-4,7-dioxo-3,5,6,8-tetrahydropyrido[2,3-d]pyrimidine-5-carboxamide (PubChem CID 136876025) has the molecular formula C21H17ClN6O6 and a molecular weight of 484.86 g/mol. Its IUPAC name is (5S)-2-(4-chloroanilino)-N-(2-methoxy-4-nitrophenyl)-4,7-dioxo-3,5,6,8-tetrahydropyrido[2,3-d]pyrimidine-5-carboxamide.
| Compound Name | (5S)-2-(4-chloroanilino)-N-(2-methoxy-4-nitrophenyl)-4,7-dioxo-3,5,6,8-tetrahydropyrido[2,3-d]pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 136876025 |
| Molecular Formula | C21H17ClN6O6 |
| Molecular Weight | 484.86 g/mol |
| Exact Mass | 484.09 |
| IUPAC Name | (5S)-2-(4-chloroanilino)-N-(2-methoxy-4-nitrophenyl)-4,7-dioxo-3,5,6,8-tetrahydropyrido[2,3-d]pyrimidine-5-carboxamide |
| SMILES | COc1cc([N+](=O)[O-])ccc1NC(=O)[C@H]1CC(=O)Nc2nc(Nc3ccc(Cl)cc3)[nH]c(=O)c21 |
| InChI | InChI=1S/C21H17ClN6O6/c1-34-15-8-12(28(32)33)6-7-14(15)24-19(30)13-9-16(29)25-18-17(13)20(31)27-21(26-18)23-11-4-2-10(22)3-5-11/h2-8,13H,9H2,1H3,(H,24,30)(H3,23,25,26,27,29,31)/t13-/m0/s1 |
| InChIKey | ALCAKIRXJLGWAC-ZDUSSCGKSA-N |
| XLogP | 3.15 |
| TPSA | 168.35 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.86 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|