C22H26N6O6 — CID 135993942
2-(3,5-dimethylpiperidin-1-yl)-N-(2-methoxy-4-nitrophenyl)-4,7-dioxo-3,5,6,8-tetrahydropyrido[2,3-d]pyrimidine-5-carboxamide (PubChem CID 135993942) has the molecular formula C22H26N6O6 and a molecular weight of 470.49 g/mol. Its IUPAC name is 2-(3,5-dimethylpiperidin-1-yl)-N-(2-methoxy-4-nitrophenyl)-4,7-dioxo-3,5,6,8-tetrahydropyrido[2,3-d]pyrimidine-5-carboxamide.
| Compound Name | 2-(3,5-dimethylpiperidin-1-yl)-N-(2-methoxy-4-nitrophenyl)-4,7-dioxo-3,5,6,8-tetrahydropyrido[2,3-d]pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 135993942 |
| Molecular Formula | C22H26N6O6 |
| Molecular Weight | 470.49 g/mol |
| Exact Mass | 470.19 |
| IUPAC Name | 2-(3,5-dimethylpiperidin-1-yl)-N-(2-methoxy-4-nitrophenyl)-4,7-dioxo-3,5,6,8-tetrahydropyrido[2,3-d]pyrimidine-5-carboxamide |
| SMILES | COc1cc([N+](=O)[O-])ccc1NC(=O)C1CC(=O)Nc2nc(N3CC(C)CC(C)C3)[nH]c(=O)c21 |
| InChI | InChI=1S/C22H26N6O6/c1-11-6-12(2)10-27(9-11)22-25-19-18(21(31)26-22)14(8-17(29)24-19)20(30)23-15-5-4-13(28(32)33)7-16(15)34-3/h4-5,7,11-12,14H,6,8-10H2,1-3H3,(H,23,30)(H2,24,25,26,29,31) |
| InChIKey | MOHUMYFAHFAGEG-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 159.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.49 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|