C21H24N6O5 — CID 136875581
(5S)-N-(2-methyl-4-nitrophenyl)-2-[(3S)-3-methylpiperidin-1-yl]-4,7-dioxo-3,5,6,8-tetrahydropyrido[2,3-d]pyrimidine-5-carboxamide (PubChem CID 136875581) has the molecular formula C21H24N6O5 and a molecular weight of 440.46 g/mol. Its IUPAC name is (5S)-N-(2-methyl-4-nitrophenyl)-2-[(3S)-3-methylpiperidin-1-yl]-4,7-dioxo-3,5,6,8-tetrahydropyrido[2,3-d]pyrimidine-5-carboxamide.
| Compound Name | (5S)-N-(2-methyl-4-nitrophenyl)-2-[(3S)-3-methylpiperidin-1-yl]-4,7-dioxo-3,5,6,8-tetrahydropyrido[2,3-d]pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 136875581 |
| Molecular Formula | C21H24N6O5 |
| Molecular Weight | 440.46 g/mol |
| Exact Mass | 440.18 |
| IUPAC Name | (5S)-N-(2-methyl-4-nitrophenyl)-2-[(3S)-3-methylpiperidin-1-yl]-4,7-dioxo-3,5,6,8-tetrahydropyrido[2,3-d]pyrimidine-5-carboxamide |
| SMILES | Cc1cc([N+](=O)[O-])ccc1NC(=O)[C@H]1CC(=O)Nc2nc(N3CCC[C@H](C)C3)[nH]c(=O)c21 |
| InChI | InChI=1S/C21H24N6O5/c1-11-4-3-7-26(10-11)21-24-18-17(20(30)25-21)14(9-16(28)23-18)19(29)22-15-6-5-13(27(31)32)8-12(15)2/h5-6,8,11,14H,3-4,7,9-10H2,1-2H3,(H,22,29)(H2,23,24,25,28,30)/t11-,14-/m0/s1 |
| InChIKey | ATGVEJUTAHBFJN-FZMZJTMJSA-N |
| XLogP | 2.29 |
| TPSA | 150.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.46 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|