C23H26N6O7 — CID 135993928
ethyl 1-[5-[(2-methyl-4-nitrophenyl)carbamoyl]-4,7-dioxo-3,5,6,8-tetrahydropyrido[2,3-d]pyrimidin-2-yl]piperidine-3-carboxylate (PubChem CID 135993928) has the molecular formula C23H26N6O7 and a molecular weight of 498.50 g/mol. Its IUPAC name is ethyl 1-[5-[(2-methyl-4-nitrophenyl)carbamoyl]-4,7-dioxo-3,5,6,8-tetrahydropyrido[2,3-d]pyrimidin-2-yl]piperidine-3-carboxylate.
| Compound Name | ethyl 1-[5-[(2-methyl-4-nitrophenyl)carbamoyl]-4,7-dioxo-3,5,6,8-tetrahydropyrido[2,3-d]pyrimidin-2-yl]piperidine-3-carboxylate |
|---|---|
| PubChem CID | 135993928 |
| Molecular Formula | C23H26N6O7 |
| Molecular Weight | 498.50 g/mol |
| Exact Mass | 498.19 |
| IUPAC Name | ethyl 1-[5-[(2-methyl-4-nitrophenyl)carbamoyl]-4,7-dioxo-3,5,6,8-tetrahydropyrido[2,3-d]pyrimidin-2-yl]piperidine-3-carboxylate |
| SMILES | CCOC(=O)C1CCCN(c2nc3c(c(=O)[nH]2)C(C(=O)Nc2ccc([N+](=O)[O-])cc2C)CC(=O)N3)C1 |
| InChI | InChI=1S/C23H26N6O7/c1-3-36-22(33)13-5-4-8-28(11-13)23-26-19-18(21(32)27-23)15(10-17(30)25-19)20(31)24-16-7-6-14(29(34)35)9-12(16)2/h6-7,9,13,15H,3-5,8,10-11H2,1-2H3,(H,24,31)(H2,25,26,27,30,32) |
| InChIKey | LIXFFUUBPMUDMU-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 176.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.50 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|