C19H20N6O5 — CID 135882068
(5S)-N-(3-nitrophenyl)-4,7-dioxo-2-piperidin-1-yl-3,5,6,8-tetrahydropyrido[2,3-d]pyrimidine-5-carboxamide (PubChem CID 135882068) has the molecular formula C19H20N6O5 and a molecular weight of 412.41 g/mol. Its IUPAC name is (5S)-N-(3-nitrophenyl)-4,7-dioxo-2-piperidin-1-yl-3,5,6,8-tetrahydropyrido[2,3-d]pyrimidine-5-carboxamide.
| Compound Name | (5S)-N-(3-nitrophenyl)-4,7-dioxo-2-piperidin-1-yl-3,5,6,8-tetrahydropyrido[2,3-d]pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 135882068 |
| Molecular Formula | C19H20N6O5 |
| Molecular Weight | 412.41 g/mol |
| Exact Mass | 412.15 |
| IUPAC Name | (5S)-N-(3-nitrophenyl)-4,7-dioxo-2-piperidin-1-yl-3,5,6,8-tetrahydropyrido[2,3-d]pyrimidine-5-carboxamide |
| SMILES | O=C1C[C@H](C(=O)Nc2cccc([N+](=O)[O-])c2)c2c(nc(N3CCCCC3)[nH]c2=O)N1 |
| InChI | InChI=1S/C19H20N6O5/c26-14-10-13(17(27)20-11-5-4-6-12(9-11)25(29)30)15-16(21-14)22-19(23-18(15)28)24-7-2-1-3-8-24/h4-6,9,13H,1-3,7-8,10H2,(H,20,27)(H2,21,22,23,26,28)/t13-/m0/s1 |
| InChIKey | FFUOXAFTTJHULD-ZDUSSCGKSA-N |
| XLogP | 1.73 |
| TPSA | 150.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.41 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|