C23H20N6O5 — CID 135994630
2-(3,4-dihydro-1H-isoquinolin-2-yl)-N-(4-nitrophenyl)-4,7-dioxo-3,5,6,8-tetrahydropyrido[2,3-d]pyrimidine-5-carboxamide (PubChem CID 135994630) has the molecular formula C23H20N6O5 and a molecular weight of 460.45 g/mol. Its IUPAC name is 2-(3,4-dihydro-1H-isoquinolin-2-yl)-N-(4-nitrophenyl)-4,7-dioxo-3,5,6,8-tetrahydropyrido[2,3-d]pyrimidine-5-carboxamide.
| Compound Name | 2-(3,4-dihydro-1H-isoquinolin-2-yl)-N-(4-nitrophenyl)-4,7-dioxo-3,5,6,8-tetrahydropyrido[2,3-d]pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 135994630 |
| Molecular Formula | C23H20N6O5 |
| Molecular Weight | 460.45 g/mol |
| Exact Mass | 460.15 |
| IUPAC Name | 2-(3,4-dihydro-1H-isoquinolin-2-yl)-N-(4-nitrophenyl)-4,7-dioxo-3,5,6,8-tetrahydropyrido[2,3-d]pyrimidine-5-carboxamide |
| SMILES | O=C1CC(C(=O)Nc2ccc([N+](=O)[O-])cc2)c2c(nc(N3CCc4ccccc4C3)[nH]c2=O)N1 |
| InChI | InChI=1S/C23H20N6O5/c30-18-11-17(21(31)24-15-5-7-16(8-6-15)29(33)34)19-20(25-18)26-23(27-22(19)32)28-10-9-13-3-1-2-4-14(13)12-28/h1-8,17H,9-12H2,(H,24,31)(H2,25,26,27,30,32) |
| InChIKey | YEUODQXSACZNHW-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 150.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.45 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|