C18H19N7O4 — CID 17036199
4-amino-N-(3-nitrophenyl)-7-oxo-2-pyrrolidin-1-yl-6,8-dihydro-5H-pyrido[2,3-d]pyrimidine-5-carboxamide (PubChem CID 17036199) has the molecular formula C18H19N7O4 and a molecular weight of 397.40 g/mol. Its IUPAC name is 4-amino-N-(3-nitrophenyl)-7-oxo-2-pyrrolidin-1-yl-6,8-dihydro-5H-pyrido[2,3-d]pyrimidine-5-carboxamide.
| Compound Name | 4-amino-N-(3-nitrophenyl)-7-oxo-2-pyrrolidin-1-yl-6,8-dihydro-5H-pyrido[2,3-d]pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 17036199 |
| Molecular Formula | C18H19N7O4 |
| Molecular Weight | 397.40 g/mol |
| Exact Mass | 397.15 |
| IUPAC Name | 4-amino-N-(3-nitrophenyl)-7-oxo-2-pyrrolidin-1-yl-6,8-dihydro-5H-pyrido[2,3-d]pyrimidine-5-carboxamide |
| SMILES | Nc1nc(N2CCCC2)nc2c1C(C(=O)Nc1cccc([N+](=O)[O-])c1)CC(=O)N2 |
| InChI | InChI=1S/C18H19N7O4/c19-15-14-12(17(27)20-10-4-3-5-11(8-10)25(28)29)9-13(26)21-16(14)23-18(22-15)24-6-1-2-7-24/h3-5,8,12H,1-2,6-7,9H2,(H,20,27)(H3,19,21,22,23,26) |
| InChIKey | HDBJQVDTWRYGEF-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 156.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.40 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|