C18H19N7O5 — CID 29102362
(5S)-4-amino-2-morpholin-4-yl-N-(4-nitrophenyl)-7-oxo-6,8-dihydro-5H-pyrido[2,3-d]pyrimidine-5-carboxamide (PubChem CID 29102362) has the molecular formula C18H19N7O5 and a molecular weight of 413.39 g/mol. Its IUPAC name is (5S)-4-amino-2-morpholin-4-yl-N-(4-nitrophenyl)-7-oxo-6,8-dihydro-5H-pyrido[2,3-d]pyrimidine-5-carboxamide.
| Compound Name | (5S)-4-amino-2-morpholin-4-yl-N-(4-nitrophenyl)-7-oxo-6,8-dihydro-5H-pyrido[2,3-d]pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 29102362 |
| Molecular Formula | C18H19N7O5 |
| Molecular Weight | 413.39 g/mol |
| Exact Mass | 413.14 |
| IUPAC Name | (5S)-4-amino-2-morpholin-4-yl-N-(4-nitrophenyl)-7-oxo-6,8-dihydro-5H-pyrido[2,3-d]pyrimidine-5-carboxamide |
| SMILES | Nc1nc(N2CCOCC2)nc2c1[C@@H](C(=O)Nc1ccc([N+](=O)[O-])cc1)CC(=O)N2 |
| InChI | InChI=1S/C18H19N7O5/c19-15-14-12(17(27)20-10-1-3-11(4-2-10)25(28)29)9-13(26)21-16(14)23-18(22-15)24-5-7-30-8-6-24/h1-4,12H,5-9H2,(H,20,27)(H3,19,21,22,23,26)/t12-/m0/s1 |
| InChIKey | REAYXCQRRHUBHI-LBPRGKRZSA-N |
| XLogP | 0.87 |
| TPSA | 165.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.39 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|