C19H21N7O5 — CID 28503982
(5R)-4-amino-N-(4-methyl-3-nitrophenyl)-2-morpholin-4-yl-7-oxo-6,8-dihydro-5H-pyrido[2,3-d]pyrimidine-5-carboxamide (PubChem CID 28503982) has the molecular formula C19H21N7O5 and a molecular weight of 427.42 g/mol. Its IUPAC name is (5R)-4-amino-N-(4-methyl-3-nitrophenyl)-2-morpholin-4-yl-7-oxo-6,8-dihydro-5H-pyrido[2,3-d]pyrimidine-5-carboxamide.
| Compound Name | (5R)-4-amino-N-(4-methyl-3-nitrophenyl)-2-morpholin-4-yl-7-oxo-6,8-dihydro-5H-pyrido[2,3-d]pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 28503982 |
| Molecular Formula | C19H21N7O5 |
| Molecular Weight | 427.42 g/mol |
| Exact Mass | 427.16 |
| IUPAC Name | (5R)-4-amino-N-(4-methyl-3-nitrophenyl)-2-morpholin-4-yl-7-oxo-6,8-dihydro-5H-pyrido[2,3-d]pyrimidine-5-carboxamide |
| SMILES | Cc1ccc(NC(=O)[C@@H]2CC(=O)Nc3nc(N4CCOCC4)nc(N)c32)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C19H21N7O5/c1-10-2-3-11(8-13(10)26(29)30)21-18(28)12-9-14(27)22-17-15(12)16(20)23-19(24-17)25-4-6-31-7-5-25/h2-3,8,12H,4-7,9H2,1H3,(H,21,28)(H3,20,22,23,24,27)/t12-/m1/s1 |
| InChIKey | VSKXHWAEAHSRKM-GFCCVEGCSA-N |
| XLogP | 1.18 |
| TPSA | 165.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.42 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|