C21H24N6O5 — CID 137028105
(5R)-2-[(2R)-2-ethylpiperidin-1-yl]-N-(3-nitrophenyl)-4,7-dioxo-3,5,6,8-tetrahydropyrido[2,3-d]pyrimidine-5-carboxamide (PubChem CID 137028105) has the molecular formula C21H24N6O5 and a molecular weight of 440.46 g/mol. Its IUPAC name is (5R)-2-[(2R)-2-ethylpiperidin-1-yl]-N-(3-nitrophenyl)-4,7-dioxo-3,5,6,8-tetrahydropyrido[2,3-d]pyrimidine-5-carboxamide.
| Compound Name | (5R)-2-[(2R)-2-ethylpiperidin-1-yl]-N-(3-nitrophenyl)-4,7-dioxo-3,5,6,8-tetrahydropyrido[2,3-d]pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 137028105 |
| Molecular Formula | C21H24N6O5 |
| Molecular Weight | 440.46 g/mol |
| Exact Mass | 440.18 |
| IUPAC Name | (5R)-2-[(2R)-2-ethylpiperidin-1-yl]-N-(3-nitrophenyl)-4,7-dioxo-3,5,6,8-tetrahydropyrido[2,3-d]pyrimidine-5-carboxamide |
| SMILES | CC[C@@H]1CCCCN1c1nc2c(c(=O)[nH]1)[C@H](C(=O)Nc1cccc([N+](=O)[O-])c1)CC(=O)N2 |
| InChI | InChI=1S/C21H24N6O5/c1-2-13-7-3-4-9-26(13)21-24-18-17(20(30)25-21)15(11-16(28)23-18)19(29)22-12-6-5-8-14(10-12)27(31)32/h5-6,8,10,13,15H,2-4,7,9,11H2,1H3,(H,22,29)(H2,23,24,25,28,30)/t13-,15-/m1/s1 |
| InChIKey | PRLYQHUUWUJINA-UKRRQHHQSA-N |
| XLogP | 2.51 |
| TPSA | 150.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.46 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|