C21H23Cl2N5O3 — CID 136875808
(5S)-N-(2,3-dichlorophenyl)-2-[(2R)-2-ethylpiperidin-1-yl]-4,7-dioxo-3,5,6,8-tetrahydropyrido[2,3-d]pyrimidine-5-carboxamide (PubChem CID 136875808) has the molecular formula C21H23Cl2N5O3 and a molecular weight of 464.35 g/mol. Its IUPAC name is (5S)-N-(2,3-dichlorophenyl)-2-[(2R)-2-ethylpiperidin-1-yl]-4,7-dioxo-3,5,6,8-tetrahydropyrido[2,3-d]pyrimidine-5-carboxamide.
| Compound Name | (5S)-N-(2,3-dichlorophenyl)-2-[(2R)-2-ethylpiperidin-1-yl]-4,7-dioxo-3,5,6,8-tetrahydropyrido[2,3-d]pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 136875808 |
| Molecular Formula | C21H23Cl2N5O3 |
| Molecular Weight | 464.35 g/mol |
| Exact Mass | 463.12 |
| IUPAC Name | (5S)-N-(2,3-dichlorophenyl)-2-[(2R)-2-ethylpiperidin-1-yl]-4,7-dioxo-3,5,6,8-tetrahydropyrido[2,3-d]pyrimidine-5-carboxamide |
| SMILES | CC[C@@H]1CCCCN1c1nc2c(c(=O)[nH]1)[C@@H](C(=O)Nc1cccc(Cl)c1Cl)CC(=O)N2 |
| InChI | InChI=1S/C21H23Cl2N5O3/c1-2-11-6-3-4-9-28(11)21-26-18-16(20(31)27-21)12(10-15(29)25-18)19(30)24-14-8-5-7-13(22)17(14)23/h5,7-8,11-12H,2-4,6,9-10H2,1H3,(H,24,30)(H2,25,26,27,29,31)/t11-,12+/m1/s1 |
| InChIKey | CWHKENDGVUZYRD-NEPJUHHUSA-N |
| XLogP | 3.91 |
| TPSA | 107.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.35 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |