C25H27N5O3 — CID 136875758
(5S)-2-[(2R)-2-ethylpiperidin-1-yl]-N-naphthalen-1-yl-4,7-dioxo-3,5,6,8-tetrahydropyrido[2,3-d]pyrimidine-5-carboxamide (PubChem CID 136875758) has the molecular formula C25H27N5O3 and a molecular weight of 445.52 g/mol. Its IUPAC name is (5S)-2-[(2R)-2-ethylpiperidin-1-yl]-N-naphthalen-1-yl-4,7-dioxo-3,5,6,8-tetrahydropyrido[2,3-d]pyrimidine-5-carboxamide.
| Compound Name | (5S)-2-[(2R)-2-ethylpiperidin-1-yl]-N-naphthalen-1-yl-4,7-dioxo-3,5,6,8-tetrahydropyrido[2,3-d]pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 136875758 |
| Molecular Formula | C25H27N5O3 |
| Molecular Weight | 445.52 g/mol |
| Exact Mass | 445.21 |
| IUPAC Name | (5S)-2-[(2R)-2-ethylpiperidin-1-yl]-N-naphthalen-1-yl-4,7-dioxo-3,5,6,8-tetrahydropyrido[2,3-d]pyrimidine-5-carboxamide |
| SMILES | CC[C@@H]1CCCCN1c1nc2c(c(=O)[nH]1)[C@@H](C(=O)Nc1cccc3ccccc13)CC(=O)N2 |
| InChI | InChI=1S/C25H27N5O3/c1-2-16-10-5-6-13-30(16)25-28-22-21(24(33)29-25)18(14-20(31)27-22)23(32)26-19-12-7-9-15-8-3-4-11-17(15)19/h3-4,7-9,11-12,16,18H,2,5-6,10,13-14H2,1H3,(H,26,32)(H2,27,28,29,31,33)/t16-,18+/m1/s1 |
| InChIKey | BQEWJQLJRNDEBK-AEFFLSMTSA-N |
| XLogP | 3.76 |
| TPSA | 107.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.52 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |