C21H23N7O6 — CID 135960345
(5S)-2-(4-carbamoylpiperidin-1-yl)-N-(2-methyl-5-nitrophenyl)-4,7-dioxo-3,5,6,8-tetrahydropyrido[2,3-d]pyrimidine-5-carboxamide (PubChem CID 135960345) has the molecular formula C21H23N7O6 and a molecular weight of 469.46 g/mol. Its IUPAC name is (5S)-2-(4-carbamoylpiperidin-1-yl)-N-(2-methyl-5-nitrophenyl)-4,7-dioxo-3,5,6,8-tetrahydropyrido[2,3-d]pyrimidine-5-carboxamide.
| Compound Name | (5S)-2-(4-carbamoylpiperidin-1-yl)-N-(2-methyl-5-nitrophenyl)-4,7-dioxo-3,5,6,8-tetrahydropyrido[2,3-d]pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 135960345 |
| Molecular Formula | C21H23N7O6 |
| Molecular Weight | 469.46 g/mol |
| Exact Mass | 469.17 |
| IUPAC Name | (5S)-2-(4-carbamoylpiperidin-1-yl)-N-(2-methyl-5-nitrophenyl)-4,7-dioxo-3,5,6,8-tetrahydropyrido[2,3-d]pyrimidine-5-carboxamide |
| SMILES | Cc1ccc([N+](=O)[O-])cc1NC(=O)[C@H]1CC(=O)Nc2nc(N3CCC(C(N)=O)CC3)[nH]c(=O)c21 |
| InChI | InChI=1S/C21H23N7O6/c1-10-2-3-12(28(33)34)8-14(10)23-19(31)13-9-15(29)24-18-16(13)20(32)26-21(25-18)27-6-4-11(5-7-27)17(22)30/h2-3,8,11,13H,4-7,9H2,1H3,(H2,22,30)(H,23,31)(H2,24,25,26,29,32)/t13-/m0/s1 |
| InChIKey | ZKHFQGYRPIUEEX-ZDUSSCGKSA-N |
| XLogP | 0.75 |
| TPSA | 193.42 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.46 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|