C21H23ClN6O4 — CID 135960340
(5R)-2-(4-carbamoylpiperidin-1-yl)-N-(5-chloro-2-methylphenyl)-4,7-dioxo-3,5,6,8-tetrahydropyrido[2,3-d]pyrimidine-5-carboxamide (PubChem CID 135960340) has the molecular formula C21H23ClN6O4 and a molecular weight of 458.91 g/mol. Its IUPAC name is (5R)-2-(4-carbamoylpiperidin-1-yl)-N-(5-chloro-2-methylphenyl)-4,7-dioxo-3,5,6,8-tetrahydropyrido[2,3-d]pyrimidine-5-carboxamide.
| Compound Name | (5R)-2-(4-carbamoylpiperidin-1-yl)-N-(5-chloro-2-methylphenyl)-4,7-dioxo-3,5,6,8-tetrahydropyrido[2,3-d]pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 135960340 |
| Molecular Formula | C21H23ClN6O4 |
| Molecular Weight | 458.91 g/mol |
| Exact Mass | 458.15 |
| IUPAC Name | (5R)-2-(4-carbamoylpiperidin-1-yl)-N-(5-chloro-2-methylphenyl)-4,7-dioxo-3,5,6,8-tetrahydropyrido[2,3-d]pyrimidine-5-carboxamide |
| SMILES | Cc1ccc(Cl)cc1NC(=O)[C@@H]1CC(=O)Nc2nc(N3CCC(C(N)=O)CC3)[nH]c(=O)c21 |
| InChI | InChI=1S/C21H23ClN6O4/c1-10-2-3-12(22)8-14(10)24-19(31)13-9-15(29)25-18-16(13)20(32)27-21(26-18)28-6-4-11(5-7-28)17(23)30/h2-3,8,11,13H,4-7,9H2,1H3,(H2,23,30)(H,24,31)(H2,25,26,27,29,32)/t13-/m1/s1 |
| InChIKey | PYUPEWAEPBUJGU-CYBMUJFWSA-N |
| XLogP | 1.50 |
| TPSA | 150.28 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.91 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |