C22H26N6O4 — CID 135960279
(5S)-2-(4-carbamoylpiperidin-1-yl)-N-(4-ethylphenyl)-4,7-dioxo-3,5,6,8-tetrahydropyrido[2,3-d]pyrimidine-5-carboxamide (PubChem CID 135960279) has the molecular formula C22H26N6O4 and a molecular weight of 438.49 g/mol. Its IUPAC name is (5S)-2-(4-carbamoylpiperidin-1-yl)-N-(4-ethylphenyl)-4,7-dioxo-3,5,6,8-tetrahydropyrido[2,3-d]pyrimidine-5-carboxamide.
| Compound Name | (5S)-2-(4-carbamoylpiperidin-1-yl)-N-(4-ethylphenyl)-4,7-dioxo-3,5,6,8-tetrahydropyrido[2,3-d]pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 135960279 |
| Molecular Formula | C22H26N6O4 |
| Molecular Weight | 438.49 g/mol |
| Exact Mass | 438.20 |
| IUPAC Name | (5S)-2-(4-carbamoylpiperidin-1-yl)-N-(4-ethylphenyl)-4,7-dioxo-3,5,6,8-tetrahydropyrido[2,3-d]pyrimidine-5-carboxamide |
| SMILES | CCc1ccc(NC(=O)[C@H]2CC(=O)Nc3nc(N4CCC(C(N)=O)CC4)[nH]c(=O)c32)cc1 |
| InChI | InChI=1S/C22H26N6O4/c1-2-12-3-5-14(6-4-12)24-20(31)15-11-16(29)25-19-17(15)21(32)27-22(26-19)28-9-7-13(8-10-28)18(23)30/h3-6,13,15H,2,7-11H2,1H3,(H2,23,30)(H,24,31)(H2,25,26,27,29,32)/t15-/m0/s1 |
| InChIKey | MVQDKMSEDZSPSD-HNNXBMFYSA-N |
| XLogP | 1.10 |
| TPSA | 150.28 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.49 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |