C21H25N5O4 — CID 135960177
(5S)-N-(4-methoxyphenyl)-2-(4-methylpiperidin-1-yl)-4,7-dioxo-3,5,6,8-tetrahydropyrido[2,3-d]pyrimidine-5-carboxamide (PubChem CID 135960177) has the molecular formula C21H25N5O4 and a molecular weight of 411.46 g/mol. Its IUPAC name is (5S)-N-(4-methoxyphenyl)-2-(4-methylpiperidin-1-yl)-4,7-dioxo-3,5,6,8-tetrahydropyrido[2,3-d]pyrimidine-5-carboxamide.
| Compound Name | (5S)-N-(4-methoxyphenyl)-2-(4-methylpiperidin-1-yl)-4,7-dioxo-3,5,6,8-tetrahydropyrido[2,3-d]pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 135960177 |
| Molecular Formula | C21H25N5O4 |
| Molecular Weight | 411.46 g/mol |
| Exact Mass | 411.19 |
| IUPAC Name | (5S)-N-(4-methoxyphenyl)-2-(4-methylpiperidin-1-yl)-4,7-dioxo-3,5,6,8-tetrahydropyrido[2,3-d]pyrimidine-5-carboxamide |
| SMILES | COc1ccc(NC(=O)[C@H]2CC(=O)Nc3nc(N4CCC(C)CC4)[nH]c(=O)c32)cc1 |
| InChI | InChI=1S/C21H25N5O4/c1-12-7-9-26(10-8-12)21-24-18-17(20(29)25-21)15(11-16(27)23-18)19(28)22-13-3-5-14(30-2)6-4-13/h3-6,12,15H,7-11H2,1-2H3,(H,22,28)(H2,23,24,25,27,29)/t15-/m0/s1 |
| InChIKey | HEZJLYMLPBEIHX-HNNXBMFYSA-N |
| XLogP | 2.08 |
| TPSA | 116.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.46 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |