C20H22N6O5 — CID 136896557
(5S)-N-(4-acetamidophenyl)-2-morpholin-4-yl-4,7-dioxo-3,5,6,8-tetrahydropyrido[2,3-d]pyrimidine-5-carboxamide (PubChem CID 136896557) has the molecular formula C20H22N6O5 and a molecular weight of 426.43 g/mol. Its IUPAC name is (5S)-N-(4-acetamidophenyl)-2-morpholin-4-yl-4,7-dioxo-3,5,6,8-tetrahydropyrido[2,3-d]pyrimidine-5-carboxamide.
| Compound Name | (5S)-N-(4-acetamidophenyl)-2-morpholin-4-yl-4,7-dioxo-3,5,6,8-tetrahydropyrido[2,3-d]pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 136896557 |
| Molecular Formula | C20H22N6O5 |
| Molecular Weight | 426.43 g/mol |
| Exact Mass | 426.17 |
| IUPAC Name | (5S)-N-(4-acetamidophenyl)-2-morpholin-4-yl-4,7-dioxo-3,5,6,8-tetrahydropyrido[2,3-d]pyrimidine-5-carboxamide |
| SMILES | CC(=O)Nc1ccc(NC(=O)[C@H]2CC(=O)Nc3nc(N4CCOCC4)[nH]c(=O)c32)cc1 |
| InChI | InChI=1S/C20H22N6O5/c1-11(27)21-12-2-4-13(5-3-12)22-18(29)14-10-15(28)23-17-16(14)19(30)25-20(24-17)26-6-8-31-9-7-26/h2-5,14H,6-10H2,1H3,(H,21,27)(H,22,29)(H2,23,24,25,28,30)/t14-/m0/s1 |
| InChIKey | NABLJMNGJHZUGP-AWEZNQCLSA-N |
| XLogP | 0.63 |
| TPSA | 145.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.43 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |