C21H22F3N5O4 — CID 136875493
(5S)-2-[(3S)-3-methylpiperidin-1-yl]-4,7-dioxo-N-[4-(trifluoromethoxy)phenyl]-3,5,6,8-tetrahydropyrido[2,3-d]pyrimidine-5-carboxamide (PubChem CID 136875493) has the molecular formula C21H22F3N5O4 and a molecular weight of 465.43 g/mol. Its IUPAC name is (5S)-2-[(3S)-3-methylpiperidin-1-yl]-4,7-dioxo-N-[4-(trifluoromethoxy)phenyl]-3,5,6,8-tetrahydropyrido[2,3-d]pyrimidine-5-carboxamide.
| Compound Name | (5S)-2-[(3S)-3-methylpiperidin-1-yl]-4,7-dioxo-N-[4-(trifluoromethoxy)phenyl]-3,5,6,8-tetrahydropyrido[2,3-d]pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 136875493 |
| Molecular Formula | C21H22F3N5O4 |
| Molecular Weight | 465.43 g/mol |
| Exact Mass | 465.16 |
| IUPAC Name | (5S)-2-[(3S)-3-methylpiperidin-1-yl]-4,7-dioxo-N-[4-(trifluoromethoxy)phenyl]-3,5,6,8-tetrahydropyrido[2,3-d]pyrimidine-5-carboxamide |
| SMILES | C[C@H]1CCCN(c2nc3c(c(=O)[nH]2)[C@@H](C(=O)Nc2ccc(OC(F)(F)F)cc2)CC(=O)N3)C1 |
| InChI | InChI=1S/C21H22F3N5O4/c1-11-3-2-8-29(10-11)20-27-17-16(19(32)28-20)14(9-15(30)26-17)18(31)25-12-4-6-13(7-5-12)33-21(22,23)24/h4-7,11,14H,2-3,8-10H2,1H3,(H,25,31)(H2,26,27,28,30,32)/t11-,14-/m0/s1 |
| InChIKey | IHEWOQODZMQRBP-FZMZJTMJSA-N |
| XLogP | 2.97 |
| TPSA | 116.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.43 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |