C21H23N5O5 — CID 136875506
(5S)-N-(1,3-benzodioxol-5-yl)-2-[(3R)-3-methylpiperidin-1-yl]-4,7-dioxo-3,5,6,8-tetrahydropyrido[2,3-d]pyrimidine-5-carboxamide (PubChem CID 136875506) has the molecular formula C21H23N5O5 and a molecular weight of 425.45 g/mol. Its IUPAC name is (5S)-N-(1,3-benzodioxol-5-yl)-2-[(3R)-3-methylpiperidin-1-yl]-4,7-dioxo-3,5,6,8-tetrahydropyrido[2,3-d]pyrimidine-5-carboxamide.
| Compound Name | (5S)-N-(1,3-benzodioxol-5-yl)-2-[(3R)-3-methylpiperidin-1-yl]-4,7-dioxo-3,5,6,8-tetrahydropyrido[2,3-d]pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 136875506 |
| Molecular Formula | C21H23N5O5 |
| Molecular Weight | 425.45 g/mol |
| Exact Mass | 425.17 |
| IUPAC Name | (5S)-N-(1,3-benzodioxol-5-yl)-2-[(3R)-3-methylpiperidin-1-yl]-4,7-dioxo-3,5,6,8-tetrahydropyrido[2,3-d]pyrimidine-5-carboxamide |
| SMILES | C[C@@H]1CCCN(c2nc3c(c(=O)[nH]2)[C@@H](C(=O)Nc2ccc4c(c2)OCO4)CC(=O)N3)C1 |
| InChI | InChI=1S/C21H23N5O5/c1-11-3-2-6-26(9-11)21-24-18-17(20(29)25-21)13(8-16(27)23-18)19(28)22-12-4-5-14-15(7-12)31-10-30-14/h4-5,7,11,13H,2-3,6,8-10H2,1H3,(H,22,28)(H2,23,24,25,27,29)/t11-,13+/m1/s1 |
| InChIKey | LMHXCPTYPCMWEG-YPMHNXCESA-N |
| XLogP | 1.80 |
| TPSA | 125.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.45 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |