C21H21ClF3N5O3 — CID 137027988
(5R)-N-[4-chloro-3-(trifluoromethyl)phenyl]-2-[(3R)-3-methylpiperidin-1-yl]-4,7-dioxo-3,5,6,8-tetrahydropyrido[2,3-d]pyrimidine-5-carboxamide (PubChem CID 137027988) has the molecular formula C21H21ClF3N5O3 and a molecular weight of 483.88 g/mol. Its IUPAC name is (5R)-N-[4-chloro-3-(trifluoromethyl)phenyl]-2-[(3R)-3-methylpiperidin-1-yl]-4,7-dioxo-3,5,6,8-tetrahydropyrido[2,3-d]pyrimidine-5-carboxamide.
| Compound Name | (5R)-N-[4-chloro-3-(trifluoromethyl)phenyl]-2-[(3R)-3-methylpiperidin-1-yl]-4,7-dioxo-3,5,6,8-tetrahydropyrido[2,3-d]pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 137027988 |
| Molecular Formula | C21H21ClF3N5O3 |
| Molecular Weight | 483.88 g/mol |
| Exact Mass | 483.13 |
| IUPAC Name | (5R)-N-[4-chloro-3-(trifluoromethyl)phenyl]-2-[(3R)-3-methylpiperidin-1-yl]-4,7-dioxo-3,5,6,8-tetrahydropyrido[2,3-d]pyrimidine-5-carboxamide |
| SMILES | C[C@@H]1CCCN(c2nc3c(c(=O)[nH]2)[C@H](C(=O)Nc2ccc(Cl)c(C(F)(F)F)c2)CC(=O)N3)C1 |
| InChI | InChI=1S/C21H21ClF3N5O3/c1-10-3-2-6-30(9-10)20-28-17-16(19(33)29-20)12(8-15(31)27-17)18(32)26-11-4-5-14(22)13(7-11)21(23,24)25/h4-5,7,10,12H,2-3,6,8-9H2,1H3,(H,26,32)(H2,27,28,29,31,33)/t10-,12-/m1/s1 |
| InChIKey | XPTCASQGILNLQU-ZYHUDNBSSA-N |
| XLogP | 3.74 |
| TPSA | 107.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.88 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |