C22H20N6O6 — CID 136876564
(5R)-2-(2-methoxyanilino)-N-(2-methyl-5-nitrophenyl)-4,7-dioxo-3,5,6,8-tetrahydropyrido[2,3-d]pyrimidine-5-carboxamide (PubChem CID 136876564) has the molecular formula C22H20N6O6 and a molecular weight of 464.44 g/mol. Its IUPAC name is (5R)-2-(2-methoxyanilino)-N-(2-methyl-5-nitrophenyl)-4,7-dioxo-3,5,6,8-tetrahydropyrido[2,3-d]pyrimidine-5-carboxamide.
| Compound Name | (5R)-2-(2-methoxyanilino)-N-(2-methyl-5-nitrophenyl)-4,7-dioxo-3,5,6,8-tetrahydropyrido[2,3-d]pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 136876564 |
| Molecular Formula | C22H20N6O6 |
| Molecular Weight | 464.44 g/mol |
| Exact Mass | 464.14 |
| IUPAC Name | (5R)-2-(2-methoxyanilino)-N-(2-methyl-5-nitrophenyl)-4,7-dioxo-3,5,6,8-tetrahydropyrido[2,3-d]pyrimidine-5-carboxamide |
| SMILES | COc1ccccc1Nc1nc2c(c(=O)[nH]1)[C@H](C(=O)Nc1cc([N+](=O)[O-])ccc1C)CC(=O)N2 |
| InChI | InChI=1S/C22H20N6O6/c1-11-7-8-12(28(32)33)9-15(11)23-20(30)13-10-17(29)25-19-18(13)21(31)27-22(26-19)24-14-5-3-4-6-16(14)34-2/h3-9,13H,10H2,1-2H3,(H,23,30)(H3,24,25,26,27,29,31)/t13-/m1/s1 |
| InChIKey | SZYXRDYMZLIASC-CYBMUJFWSA-N |
| XLogP | 2.80 |
| TPSA | 168.35 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.44 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|