C22H20ClN5O4 — CID 135994786
N-(5-chloro-2-methylphenyl)-2-(2-methoxyanilino)-4,7-dioxo-3,5,6,8-tetrahydropyrido[2,3-d]pyrimidine-5-carboxamide (PubChem CID 135994786) has the molecular formula C22H20ClN5O4 and a molecular weight of 453.89 g/mol. Its IUPAC name is N-(5-chloro-2-methylphenyl)-2-(2-methoxyanilino)-4,7-dioxo-3,5,6,8-tetrahydropyrido[2,3-d]pyrimidine-5-carboxamide.
| Compound Name | N-(5-chloro-2-methylphenyl)-2-(2-methoxyanilino)-4,7-dioxo-3,5,6,8-tetrahydropyrido[2,3-d]pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 135994786 |
| Molecular Formula | C22H20ClN5O4 |
| Molecular Weight | 453.89 g/mol |
| Exact Mass | 453.12 |
| IUPAC Name | N-(5-chloro-2-methylphenyl)-2-(2-methoxyanilino)-4,7-dioxo-3,5,6,8-tetrahydropyrido[2,3-d]pyrimidine-5-carboxamide |
| SMILES | COc1ccccc1Nc1nc2c(c(=O)[nH]1)C(C(=O)Nc1cc(Cl)ccc1C)CC(=O)N2 |
| InChI | InChI=1S/C22H20ClN5O4/c1-11-7-8-12(23)9-15(11)24-20(30)13-10-17(29)26-19-18(13)21(31)28-22(27-19)25-14-5-3-4-6-16(14)32-2/h3-9,13H,10H2,1-2H3,(H,24,30)(H3,25,26,27,28,29,31) |
| InChIKey | VRORCLZAWAFXNP-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 125.21 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.89 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |