C18H17Cl2N5O3 — CID 135994705
N-(3,5-dichlorophenyl)-4,7-dioxo-2-pyrrolidin-1-yl-3,5,6,8-tetrahydropyrido[2,3-d]pyrimidine-5-carboxamide (PubChem CID 135994705) has the molecular formula C18H17Cl2N5O3 and a molecular weight of 422.27 g/mol. Its IUPAC name is N-(3,5-dichlorophenyl)-4,7-dioxo-2-pyrrolidin-1-yl-3,5,6,8-tetrahydropyrido[2,3-d]pyrimidine-5-carboxamide.
| Compound Name | N-(3,5-dichlorophenyl)-4,7-dioxo-2-pyrrolidin-1-yl-3,5,6,8-tetrahydropyrido[2,3-d]pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 135994705 |
| Molecular Formula | C18H17Cl2N5O3 |
| Molecular Weight | 422.27 g/mol |
| Exact Mass | 421.07 |
| IUPAC Name | N-(3,5-dichlorophenyl)-4,7-dioxo-2-pyrrolidin-1-yl-3,5,6,8-tetrahydropyrido[2,3-d]pyrimidine-5-carboxamide |
| SMILES | O=C1CC(C(=O)Nc2cc(Cl)cc(Cl)c2)c2c(nc(N3CCCC3)[nH]c2=O)N1 |
| InChI | InChI=1S/C18H17Cl2N5O3/c19-9-5-10(20)7-11(6-9)21-16(27)12-8-13(26)22-15-14(12)17(28)24-18(23-15)25-3-1-2-4-25/h5-7,12H,1-4,8H2,(H,21,27)(H2,22,23,24,26,28) |
| InChIKey | DCFXOCVTFPLMGX-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 107.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.27 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |