C22H23N5O7 — CID 135937709
dimethyl 5-[[(5S)-4,7-dioxo-2-pyrrolidin-1-yl-3,5,6,8-tetrahydropyrido[2,3-d]pyrimidine-5-carbonyl]amino]benzene-1,3-dicarboxylate (PubChem CID 135937709) has the molecular formula C22H23N5O7 and a molecular weight of 469.45 g/mol. Its IUPAC name is dimethyl 5-[[(5S)-4,7-dioxo-2-pyrrolidin-1-yl-3,5,6,8-tetrahydropyrido[2,3-d]pyrimidine-5-carbonyl]amino]benzene-1,3-dicarboxylate.
| Compound Name | dimethyl 5-[[(5S)-4,7-dioxo-2-pyrrolidin-1-yl-3,5,6,8-tetrahydropyrido[2,3-d]pyrimidine-5-carbonyl]amino]benzene-1,3-dicarboxylate |
|---|---|
| PubChem CID | 135937709 |
| Molecular Formula | C22H23N5O7 |
| Molecular Weight | 469.45 g/mol |
| Exact Mass | 469.16 |
| IUPAC Name | dimethyl 5-[[(5S)-4,7-dioxo-2-pyrrolidin-1-yl-3,5,6,8-tetrahydropyrido[2,3-d]pyrimidine-5-carbonyl]amino]benzene-1,3-dicarboxylate |
| SMILES | COC(=O)c1cc(NC(=O)[C@H]2CC(=O)Nc3nc(N4CCCC4)[nH]c(=O)c32)cc(C(=O)OC)c1 |
| InChI | InChI=1S/C22H23N5O7/c1-33-20(31)11-7-12(21(32)34-2)9-13(8-11)23-18(29)14-10-15(28)24-17-16(14)19(30)26-22(25-17)27-5-3-4-6-27/h7-9,14H,3-6,10H2,1-2H3,(H,23,29)(H2,24,25,26,28,30)/t14-/m0/s1 |
| InChIKey | GVNQKKDREPGYIP-AWEZNQCLSA-N |
| XLogP | 1.01 |
| TPSA | 159.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.45 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |