C24H29N5O7 — CID 135994098
ethyl 1-[5-[(2,5-dimethoxyphenyl)carbamoyl]-4,7-dioxo-3,5,6,8-tetrahydropyrido[2,3-d]pyrimidin-2-yl]piperidine-3-carboxylate (PubChem CID 135994098) has the molecular formula C24H29N5O7 and a molecular weight of 499.52 g/mol. Its IUPAC name is ethyl 1-[5-[(2,5-dimethoxyphenyl)carbamoyl]-4,7-dioxo-3,5,6,8-tetrahydropyrido[2,3-d]pyrimidin-2-yl]piperidine-3-carboxylate.
| Compound Name | ethyl 1-[5-[(2,5-dimethoxyphenyl)carbamoyl]-4,7-dioxo-3,5,6,8-tetrahydropyrido[2,3-d]pyrimidin-2-yl]piperidine-3-carboxylate |
|---|---|
| PubChem CID | 135994098 |
| Molecular Formula | C24H29N5O7 |
| Molecular Weight | 499.52 g/mol |
| Exact Mass | 499.21 |
| IUPAC Name | ethyl 1-[5-[(2,5-dimethoxyphenyl)carbamoyl]-4,7-dioxo-3,5,6,8-tetrahydropyrido[2,3-d]pyrimidin-2-yl]piperidine-3-carboxylate |
| SMILES | CCOC(=O)C1CCCN(c2nc3c(c(=O)[nH]2)C(C(=O)Nc2cc(OC)ccc2OC)CC(=O)N3)C1 |
| InChI | InChI=1S/C24H29N5O7/c1-4-36-23(33)13-6-5-9-29(12-13)24-27-20-19(22(32)28-24)15(11-18(30)26-20)21(31)25-16-10-14(34-2)7-8-17(16)35-3/h7-8,10,13,15H,4-6,9,11-12H2,1-3H3,(H,25,31)(H2,26,27,28,30,32) |
| InChIKey | VDZOKWXICRALLX-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 151.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.52 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |