C20H14Cl2N6O5 — CID 136876274
(5R)-2-(2,4-dichloroanilino)-N-(4-nitrophenyl)-4,7-dioxo-3,5,6,8-tetrahydropyrido[2,3-d]pyrimidine-5-carboxamide (PubChem CID 136876274) has the molecular formula C20H14Cl2N6O5 and a molecular weight of 489.28 g/mol. Its IUPAC name is (5R)-2-(2,4-dichloroanilino)-N-(4-nitrophenyl)-4,7-dioxo-3,5,6,8-tetrahydropyrido[2,3-d]pyrimidine-5-carboxamide.
| Compound Name | (5R)-2-(2,4-dichloroanilino)-N-(4-nitrophenyl)-4,7-dioxo-3,5,6,8-tetrahydropyrido[2,3-d]pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 136876274 |
| Molecular Formula | C20H14Cl2N6O5 |
| Molecular Weight | 489.28 g/mol |
| Exact Mass | 488.04 |
| IUPAC Name | (5R)-2-(2,4-dichloroanilino)-N-(4-nitrophenyl)-4,7-dioxo-3,5,6,8-tetrahydropyrido[2,3-d]pyrimidine-5-carboxamide |
| SMILES | O=C1C[C@@H](C(=O)Nc2ccc([N+](=O)[O-])cc2)c2c(nc(Nc3ccc(Cl)cc3Cl)[nH]c2=O)N1 |
| InChI | InChI=1S/C20H14Cl2N6O5/c21-9-1-6-14(13(22)7-9)24-20-26-17-16(19(31)27-20)12(8-15(29)25-17)18(30)23-10-2-4-11(5-3-10)28(32)33/h1-7,12H,8H2,(H,23,30)(H3,24,25,26,27,29,31)/t12-/m1/s1 |
| InChIKey | WLDCPGXKWFNADR-GFCCVEGCSA-N |
| XLogP | 3.79 |
| TPSA | 159.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.28 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|