C25H23Cl2N5O5 — CID 136719655
butyl 4-[[(5R)-2-(2,4-dichloroanilino)-4,7-dioxo-3,5,6,8-tetrahydropyrido[2,3-d]pyrimidine-5-carbonyl]amino]benzoate (PubChem CID 136719655) has the molecular formula C25H23Cl2N5O5 and a molecular weight of 544.40 g/mol. Its IUPAC name is butyl 4-[[(5R)-2-(2,4-dichloroanilino)-4,7-dioxo-3,5,6,8-tetrahydropyrido[2,3-d]pyrimidine-5-carbonyl]amino]benzoate.
| Compound Name | butyl 4-[[(5R)-2-(2,4-dichloroanilino)-4,7-dioxo-3,5,6,8-tetrahydropyrido[2,3-d]pyrimidine-5-carbonyl]amino]benzoate |
|---|---|
| PubChem CID | 136719655 |
| Molecular Formula | C25H23Cl2N5O5 |
| Molecular Weight | 544.40 g/mol |
| Exact Mass | 543.11 |
| IUPAC Name | butyl 4-[[(5R)-2-(2,4-dichloroanilino)-4,7-dioxo-3,5,6,8-tetrahydropyrido[2,3-d]pyrimidine-5-carbonyl]amino]benzoate |
| SMILES | CCCCOC(=O)c1ccc(NC(=O)[C@@H]2CC(=O)Nc3nc(Nc4ccc(Cl)cc4Cl)[nH]c(=O)c32)cc1 |
| InChI | InChI=1S/C25H23Cl2N5O5/c1-2-3-10-37-24(36)13-4-7-15(8-5-13)28-22(34)16-12-19(33)30-21-20(16)23(35)32-25(31-21)29-18-9-6-14(26)11-17(18)27/h4-9,11,16H,2-3,10,12H2,1H3,(H,28,34)(H3,29,30,31,32,33,35)/t16-/m1/s1 |
| InChIKey | UVESUBSZIJKKBE-MRXNPFEDSA-N |
| XLogP | 4.84 |
| TPSA | 142.28 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.40 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|