C26H33N5O5 — CID 136875723
butyl 4-[[(5S)-2-[(2S)-2-ethylpiperidin-1-yl]-4,7-dioxo-3,5,6,8-tetrahydropyrido[2,3-d]pyrimidine-5-carbonyl]amino]benzoate (PubChem CID 136875723) has the molecular formula C26H33N5O5 and a molecular weight of 495.58 g/mol. Its IUPAC name is butyl 4-[[(5S)-2-[(2S)-2-ethylpiperidin-1-yl]-4,7-dioxo-3,5,6,8-tetrahydropyrido[2,3-d]pyrimidine-5-carbonyl]amino]benzoate.
| Compound Name | butyl 4-[[(5S)-2-[(2S)-2-ethylpiperidin-1-yl]-4,7-dioxo-3,5,6,8-tetrahydropyrido[2,3-d]pyrimidine-5-carbonyl]amino]benzoate |
|---|---|
| PubChem CID | 136875723 |
| Molecular Formula | C26H33N5O5 |
| Molecular Weight | 495.58 g/mol |
| Exact Mass | 495.25 |
| IUPAC Name | butyl 4-[[(5S)-2-[(2S)-2-ethylpiperidin-1-yl]-4,7-dioxo-3,5,6,8-tetrahydropyrido[2,3-d]pyrimidine-5-carbonyl]amino]benzoate |
| SMILES | CCCCOC(=O)c1ccc(NC(=O)[C@H]2CC(=O)Nc3nc(N4CCCC[C@@H]4CC)[nH]c(=O)c32)cc1 |
| InChI | InChI=1S/C26H33N5O5/c1-3-5-14-36-25(35)16-9-11-17(12-10-16)27-23(33)19-15-20(32)28-22-21(19)24(34)30-26(29-22)31-13-7-6-8-18(31)4-2/h9-12,18-19H,3-8,13-15H2,1-2H3,(H,27,33)(H2,28,29,30,32,34)/t18-,19-/m0/s1 |
| InChIKey | MWTSLASUCLHMEY-OALUTQOASA-N |
| XLogP | 3.56 |
| TPSA | 133.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.58 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|