C17H25N5O3 — CID 136875762
(5S)-N-ethyl-2-[(2R)-2-ethylpiperidin-1-yl]-4,7-dioxo-3,5,6,8-tetrahydropyrido[2,3-d]pyrimidine-5-carboxamide (PubChem CID 136875762) has the molecular formula C17H25N5O3 and a molecular weight of 347.42 g/mol. Its IUPAC name is (5S)-N-ethyl-2-[(2R)-2-ethylpiperidin-1-yl]-4,7-dioxo-3,5,6,8-tetrahydropyrido[2,3-d]pyrimidine-5-carboxamide.
| Compound Name | (5S)-N-ethyl-2-[(2R)-2-ethylpiperidin-1-yl]-4,7-dioxo-3,5,6,8-tetrahydropyrido[2,3-d]pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 136875762 |
| Molecular Formula | C17H25N5O3 |
| Molecular Weight | 347.42 g/mol |
| Exact Mass | 347.20 |
| IUPAC Name | (5S)-N-ethyl-2-[(2R)-2-ethylpiperidin-1-yl]-4,7-dioxo-3,5,6,8-tetrahydropyrido[2,3-d]pyrimidine-5-carboxamide |
| SMILES | CCNC(=O)[C@H]1CC(=O)Nc2nc(N3CCCC[C@H]3CC)[nH]c(=O)c21 |
| InChI | InChI=1S/C17H25N5O3/c1-3-10-7-5-6-8-22(10)17-20-14-13(16(25)21-17)11(9-12(23)19-14)15(24)18-4-2/h10-11H,3-9H2,1-2H3,(H,18,24)(H2,19,20,21,23,25)/t10-,11+/m1/s1 |
| InChIKey | KCUIPDAMCAQWSZ-MNOVXSKESA-N |
| XLogP | 1.10 |
| TPSA | 107.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.42 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |