C24H20F3N5O5 — CID 136876633
ethyl 4-[[(5S)-4,7-dioxo-2-[3-(trifluoromethyl)anilino]-3,5,6,8-tetrahydropyrido[2,3-d]pyrimidine-5-carbonyl]amino]benzoate (PubChem CID 136876633) has the molecular formula C24H20F3N5O5 and a molecular weight of 515.45 g/mol. Its IUPAC name is ethyl 4-[[(5S)-4,7-dioxo-2-[3-(trifluoromethyl)anilino]-3,5,6,8-tetrahydropyrido[2,3-d]pyrimidine-5-carbonyl]amino]benzoate.
| Compound Name | ethyl 4-[[(5S)-4,7-dioxo-2-[3-(trifluoromethyl)anilino]-3,5,6,8-tetrahydropyrido[2,3-d]pyrimidine-5-carbonyl]amino]benzoate |
|---|---|
| PubChem CID | 136876633 |
| Molecular Formula | C24H20F3N5O5 |
| Molecular Weight | 515.45 g/mol |
| Exact Mass | 515.14 |
| IUPAC Name | ethyl 4-[[(5S)-4,7-dioxo-2-[3-(trifluoromethyl)anilino]-3,5,6,8-tetrahydropyrido[2,3-d]pyrimidine-5-carbonyl]amino]benzoate |
| SMILES | CCOC(=O)c1ccc(NC(=O)[C@H]2CC(=O)Nc3nc(Nc4cccc(C(F)(F)F)c4)[nH]c(=O)c32)cc1 |
| InChI | InChI=1S/C24H20F3N5O5/c1-2-37-22(36)12-6-8-14(9-7-12)28-20(34)16-11-17(33)30-19-18(16)21(35)32-23(31-19)29-15-5-3-4-13(10-15)24(25,26)27/h3-10,16H,2,11H2,1H3,(H,28,34)(H3,29,30,31,32,33,35)/t16-/m0/s1 |
| InChIKey | RHMOFIWXDALXEX-INIZCTEOSA-N |
| XLogP | 3.77 |
| TPSA | 142.28 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.45 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |