C23H18F3N5O4 — CID 136876630
(5R)-N-(4-acetylphenyl)-4,7-dioxo-2-[3-(trifluoromethyl)anilino]-3,5,6,8-tetrahydropyrido[2,3-d]pyrimidine-5-carboxamide (PubChem CID 136876630) has the molecular formula C23H18F3N5O4 and a molecular weight of 485.42 g/mol. Its IUPAC name is (5R)-N-(4-acetylphenyl)-4,7-dioxo-2-[3-(trifluoromethyl)anilino]-3,5,6,8-tetrahydropyrido[2,3-d]pyrimidine-5-carboxamide.
| Compound Name | (5R)-N-(4-acetylphenyl)-4,7-dioxo-2-[3-(trifluoromethyl)anilino]-3,5,6,8-tetrahydropyrido[2,3-d]pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 136876630 |
| Molecular Formula | C23H18F3N5O4 |
| Molecular Weight | 485.42 g/mol |
| Exact Mass | 485.13 |
| IUPAC Name | (5R)-N-(4-acetylphenyl)-4,7-dioxo-2-[3-(trifluoromethyl)anilino]-3,5,6,8-tetrahydropyrido[2,3-d]pyrimidine-5-carboxamide |
| SMILES | CC(=O)c1ccc(NC(=O)[C@@H]2CC(=O)Nc3nc(Nc4cccc(C(F)(F)F)c4)[nH]c(=O)c32)cc1 |
| InChI | InChI=1S/C23H18F3N5O4/c1-11(32)12-5-7-14(8-6-12)27-20(34)16-10-17(33)29-19-18(16)21(35)31-22(30-19)28-15-4-2-3-13(9-15)23(24,25)26/h2-9,16H,10H2,1H3,(H,27,34)(H3,28,29,30,31,33,35)/t16-/m1/s1 |
| InChIKey | FSHCAFPBUMTBNV-MRXNPFEDSA-N |
| XLogP | 3.80 |
| TPSA | 133.05 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.42 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |