C21H14Cl2F3N5O3 — CID 136876649
(5R)-N-(2,4-dichlorophenyl)-4,7-dioxo-2-[3-(trifluoromethyl)anilino]-3,5,6,8-tetrahydropyrido[2,3-d]pyrimidine-5-carboxamide (PubChem CID 136876649) has the molecular formula C21H14Cl2F3N5O3 and a molecular weight of 512.28 g/mol. Its IUPAC name is (5R)-N-(2,4-dichlorophenyl)-4,7-dioxo-2-[3-(trifluoromethyl)anilino]-3,5,6,8-tetrahydropyrido[2,3-d]pyrimidine-5-carboxamide.
| Compound Name | (5R)-N-(2,4-dichlorophenyl)-4,7-dioxo-2-[3-(trifluoromethyl)anilino]-3,5,6,8-tetrahydropyrido[2,3-d]pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 136876649 |
| Molecular Formula | C21H14Cl2F3N5O3 |
| Molecular Weight | 512.28 g/mol |
| Exact Mass | 511.04 |
| IUPAC Name | (5R)-N-(2,4-dichlorophenyl)-4,7-dioxo-2-[3-(trifluoromethyl)anilino]-3,5,6,8-tetrahydropyrido[2,3-d]pyrimidine-5-carboxamide |
| SMILES | O=C1C[C@@H](C(=O)Nc2ccc(Cl)cc2Cl)c2c(nc(Nc3cccc(C(F)(F)F)c3)[nH]c2=O)N1 |
| InChI | InChI=1S/C21H14Cl2F3N5O3/c22-10-4-5-14(13(23)7-10)28-18(33)12-8-15(32)29-17-16(12)19(34)31-20(30-17)27-11-3-1-2-9(6-11)21(24,25)26/h1-7,12H,8H2,(H,28,33)(H3,27,29,30,31,32,34)/t12-/m1/s1 |
| InChIKey | DSDAZFWSTOOQNP-GFCCVEGCSA-N |
| XLogP | 4.90 |
| TPSA | 115.98 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.28 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |