C20H14Cl3N5O3 — CID 136876012
(5S)-2-(4-chloroanilino)-N-(3,5-dichlorophenyl)-4,7-dioxo-3,5,6,8-tetrahydropyrido[2,3-d]pyrimidine-5-carboxamide (PubChem CID 136876012) has the molecular formula C20H14Cl3N5O3 and a molecular weight of 478.72 g/mol. Its IUPAC name is (5S)-2-(4-chloroanilino)-N-(3,5-dichlorophenyl)-4,7-dioxo-3,5,6,8-tetrahydropyrido[2,3-d]pyrimidine-5-carboxamide.
| Compound Name | (5S)-2-(4-chloroanilino)-N-(3,5-dichlorophenyl)-4,7-dioxo-3,5,6,8-tetrahydropyrido[2,3-d]pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 136876012 |
| Molecular Formula | C20H14Cl3N5O3 |
| Molecular Weight | 478.72 g/mol |
| Exact Mass | 477.02 |
| IUPAC Name | (5S)-2-(4-chloroanilino)-N-(3,5-dichlorophenyl)-4,7-dioxo-3,5,6,8-tetrahydropyrido[2,3-d]pyrimidine-5-carboxamide |
| SMILES | O=C1C[C@H](C(=O)Nc2cc(Cl)cc(Cl)c2)c2c(nc(Nc3ccc(Cl)cc3)[nH]c2=O)N1 |
| InChI | InChI=1S/C20H14Cl3N5O3/c21-9-1-3-12(4-2-9)25-20-27-17-16(19(31)28-20)14(8-15(29)26-17)18(30)24-13-6-10(22)5-11(23)7-13/h1-7,14H,8H2,(H,24,30)(H3,25,26,27,28,29,31)/t14-/m0/s1 |
| InChIKey | KSTREMLLURNSKY-AWEZNQCLSA-N |
| XLogP | 4.54 |
| TPSA | 115.98 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.72 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |