C23H23N5O3 — CID 136876701
(5R)-N-(3,5-dimethylphenyl)-2-(4-methylanilino)-4,7-dioxo-3,5,6,8-tetrahydropyrido[2,3-d]pyrimidine-5-carboxamide (PubChem CID 136876701) has the molecular formula C23H23N5O3 and a molecular weight of 417.47 g/mol. Its IUPAC name is (5R)-N-(3,5-dimethylphenyl)-2-(4-methylanilino)-4,7-dioxo-3,5,6,8-tetrahydropyrido[2,3-d]pyrimidine-5-carboxamide.
| Compound Name | (5R)-N-(3,5-dimethylphenyl)-2-(4-methylanilino)-4,7-dioxo-3,5,6,8-tetrahydropyrido[2,3-d]pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 136876701 |
| Molecular Formula | C23H23N5O3 |
| Molecular Weight | 417.47 g/mol |
| Exact Mass | 417.18 |
| IUPAC Name | (5R)-N-(3,5-dimethylphenyl)-2-(4-methylanilino)-4,7-dioxo-3,5,6,8-tetrahydropyrido[2,3-d]pyrimidine-5-carboxamide |
| SMILES | Cc1ccc(Nc2nc3c(c(=O)[nH]2)[C@H](C(=O)Nc2cc(C)cc(C)c2)CC(=O)N3)cc1 |
| InChI | InChI=1S/C23H23N5O3/c1-12-4-6-15(7-5-12)25-23-27-20-19(22(31)28-23)17(11-18(29)26-20)21(30)24-16-9-13(2)8-14(3)10-16/h4-10,17H,11H2,1-3H3,(H,24,30)(H3,25,26,27,28,29,31)/t17-/m1/s1 |
| InChIKey | VSGLDTLLAVFEIA-QGZVFWFLSA-N |
| XLogP | 3.50 |
| TPSA | 115.98 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.47 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |