C26H20ClN5O3S — CID 136876089
(5S)-2-(3-chloroanilino)-4,7-dioxo-N-(2-phenylsulfanylphenyl)-3,5,6,8-tetrahydropyrido[2,3-d]pyrimidine-5-carboxamide (PubChem CID 136876089) has the molecular formula C26H20ClN5O3S and a molecular weight of 518.00 g/mol. Its IUPAC name is (5S)-2-(3-chloroanilino)-4,7-dioxo-N-(2-phenylsulfanylphenyl)-3,5,6,8-tetrahydropyrido[2,3-d]pyrimidine-5-carboxamide.
| Compound Name | (5S)-2-(3-chloroanilino)-4,7-dioxo-N-(2-phenylsulfanylphenyl)-3,5,6,8-tetrahydropyrido[2,3-d]pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 136876089 |
| Molecular Formula | C26H20ClN5O3S |
| Molecular Weight | 518.00 g/mol |
| Exact Mass | 517.10 |
| IUPAC Name | (5S)-2-(3-chloroanilino)-4,7-dioxo-N-(2-phenylsulfanylphenyl)-3,5,6,8-tetrahydropyrido[2,3-d]pyrimidine-5-carboxamide |
| SMILES | O=C1C[C@H](C(=O)Nc2ccccc2Sc2ccccc2)c2c(nc(Nc3cccc(Cl)c3)[nH]c2=O)N1 |
| InChI | InChI=1S/C26H20ClN5O3S/c27-15-7-6-8-16(13-15)28-26-31-23-22(25(35)32-26)18(14-21(33)30-23)24(34)29-19-11-4-5-12-20(19)36-17-9-2-1-3-10-17/h1-13,18H,14H2,(H,29,34)(H3,28,30,31,32,33,35)/t18-/m0/s1 |
| InChIKey | QKKKOMBSYKPLFI-SFHVURJKSA-N |
| XLogP | 5.38 |
| TPSA | 115.98 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.00 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |