C16H15FN4O3S — CID 135986849
N-(5-fluoro-2-methylphenyl)-2-methylsulfanyl-4,7-dioxo-3,5,6,8-tetrahydropyrido[2,3-d]pyrimidine-5-carboxamide (PubChem CID 135986849) has the molecular formula C16H15FN4O3S and a molecular weight of 362.39 g/mol. Its IUPAC name is N-(5-fluoro-2-methylphenyl)-2-methylsulfanyl-4,7-dioxo-3,5,6,8-tetrahydropyrido[2,3-d]pyrimidine-5-carboxamide.
| Compound Name | N-(5-fluoro-2-methylphenyl)-2-methylsulfanyl-4,7-dioxo-3,5,6,8-tetrahydropyrido[2,3-d]pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 135986849 |
| Molecular Formula | C16H15FN4O3S |
| Molecular Weight | 362.39 g/mol |
| Exact Mass | 362.08 |
| IUPAC Name | N-(5-fluoro-2-methylphenyl)-2-methylsulfanyl-4,7-dioxo-3,5,6,8-tetrahydropyrido[2,3-d]pyrimidine-5-carboxamide |
| SMILES | CSc1nc2c(c(=O)[nH]1)C(C(=O)Nc1cc(F)ccc1C)CC(=O)N2 |
| InChI | InChI=1S/C16H15FN4O3S/c1-7-3-4-8(17)5-10(7)18-14(23)9-6-11(22)19-13-12(9)15(24)21-16(20-13)25-2/h3-5,9H,6H2,1-2H3,(H,18,23)(H2,19,20,21,22,24) |
| InChIKey | VYBPXEKNBTVSFS-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 103.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.39 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |