C17H14F2N4O3S — CID 136860108
(5R)-N-(2,5-difluorophenyl)-4,7-dioxo-2-prop-2-enylsulfanyl-3,5,6,8-tetrahydropyrido[2,3-d]pyrimidine-5-carboxamide (PubChem CID 136860108) has the molecular formula C17H14F2N4O3S and a molecular weight of 392.39 g/mol. Its IUPAC name is (5R)-N-(2,5-difluorophenyl)-4,7-dioxo-2-prop-2-enylsulfanyl-3,5,6,8-tetrahydropyrido[2,3-d]pyrimidine-5-carboxamide.
| Compound Name | (5R)-N-(2,5-difluorophenyl)-4,7-dioxo-2-prop-2-enylsulfanyl-3,5,6,8-tetrahydropyrido[2,3-d]pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 136860108 |
| Molecular Formula | C17H14F2N4O3S |
| Molecular Weight | 392.39 g/mol |
| Exact Mass | 392.08 |
| IUPAC Name | (5R)-N-(2,5-difluorophenyl)-4,7-dioxo-2-prop-2-enylsulfanyl-3,5,6,8-tetrahydropyrido[2,3-d]pyrimidine-5-carboxamide |
| SMILES | C=CCSc1nc2c(c(=O)[nH]1)[C@H](C(=O)Nc1cc(F)ccc1F)CC(=O)N2 |
| InChI | InChI=1S/C17H14F2N4O3S/c1-2-5-27-17-22-14-13(16(26)23-17)9(7-12(24)21-14)15(25)20-11-6-8(18)3-4-10(11)19/h2-4,6,9H,1,5,7H2,(H,20,25)(H2,21,22,23,24,26)/t9-/m1/s1 |
| InChIKey | DRNVHSSHYBBILH-SECBINFHSA-N |
| XLogP | 2.39 |
| TPSA | 103.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.39 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|